C31H21BrClN3O3 — CID 126131388
[4-bromo-2-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126131388) has the molecular formula C31H21BrClN3O3 and a molecular weight of 598.88 g/mol. Its IUPAC name is [4-bromo-2-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-bromo-2-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126131388 |
| Molecular Formula | C31H21BrClN3O3 |
| Molecular Weight | 598.88 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | [4-bromo-2-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)ccc2OC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H21BrClN3O3/c1-20-6-11-22(12-7-20)30-35-27-5-3-2-4-26(27)31(38)36(30)34-19-23-18-24(32)13-16-28(23)39-29(37)17-10-21-8-14-25(33)15-9-21/h2-19H,1H3/b17-10+,34-19? |
| InChIKey | MLTWJQIIXGWCIM-GMLPUBQDSA-N |
| XLogP | 7.29 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.88 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|