C31H24N4O6 — CID 126137216
[2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate (PubChem CID 126137216) has the molecular formula C31H24N4O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126137216 |
| Molecular Formula | C31H24N4O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc([N+](=O)[O-])cc3)nc3ccccc3c2=O)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C31H24N4O6/c1-3-40-28-18-21(11-16-27(28)41-31(37)23-8-6-7-20(2)17-23)19-32-34-29(22-12-14-24(15-13-22)35(38)39)33-26-10-5-4-9-25(26)30(34)36/h4-19H,3H2,1-2H3 |
| InChIKey | OHLRHHBHSAIIKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|