C29H20F3N5O5 — CID 126310063
3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126310063) has the molecular formula C29H20F3N5O5 and a molecular weight of 575.50 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126310063 |
| Molecular Formula | C29H20F3N5O5 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C29H20F3N5O5/c1-2-41-25-14-18(10-12-24(25)42-26-13-11-21(17-33-26)37(39)40)16-34-36-27(19-6-5-7-20(15-19)29(30,31)32)35-23-9-4-3-8-22(23)28(36)38/h3-17H,2H2,1H3 |
| InChIKey | ILZIHEQJAWNWJN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|