C28H24F3N3O5 — CID 126285395
ethyl 2-[2-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate (PubChem CID 126285395) has the molecular formula C28H24F3N3O5 and a molecular weight of 539.51 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126285395 |
| Molecular Formula | C28H24F3N3O5 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1OCC |
| InChI | InChI=1S/C28H24F3N3O5/c1-3-37-24-14-18(12-13-23(24)39-17-25(35)38-4-2)16-32-34-26(19-8-7-9-20(15-19)28(29,30)31)33-22-11-6-5-10-21(22)27(34)36/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | HAPBTXUWRYTRCU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|