C32H23F3IN3O5 — CID 126294689
4-[[2-ethoxy-6-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126294689) has the molecular formula C32H23F3IN3O5 and a molecular weight of 713.45 g/mol. Its IUPAC name is 4-[[2-ethoxy-6-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-ethoxy-6-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126294689 |
| Molecular Formula | C32H23F3IN3O5 |
| Molecular Weight | 713.45 g/mol |
| Exact Mass | 713.06 |
| IUPAC Name | 4-[[2-ethoxy-6-iodo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc(I)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H23F3IN3O5/c1-2-43-27-15-20(14-25(36)28(27)44-18-19-10-12-21(13-11-19)31(41)42)17-37-39-29(22-6-5-7-23(16-22)32(33,34)35)38-26-9-4-3-8-24(26)30(39)40/h3-17H,2,18H2,1H3,(H,41,42) |
| InChIKey | AUOPIKVDQXYWKF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.45 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|