C34H26F3N3O5 — CID 126284764
4-[[2-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126284764) has the molecular formula C34H26F3N3O5 and a molecular weight of 613.59 g/mol. Its IUPAC name is 4-[[2-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126284764 |
| Molecular Formula | C34H26F3N3O5 |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 4-[[2-methoxy-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H26F3N3O5/c1-3-7-24-16-22(17-29(44-2)30(24)45-20-21-12-14-23(15-13-21)33(42)43)19-38-40-31(25-8-6-9-26(18-25)34(35,36)37)39-28-11-5-4-10-27(28)32(40)41/h3-6,8-19H,1,7,20H2,2H3,(H,42,43) |
| InChIKey | GGZRHRWIAQDMRX-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|