C33H27N3O5 — CID 126406790
4-[[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126406790) has the molecular formula C33H27N3O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126406790 |
| Molecular Formula | C33H27N3O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 4-[[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H27N3O5/c1-3-9-26-18-23(19-29(40-2)30(26)41-21-22-14-16-25(17-15-22)33(38)39)20-34-36-31(24-10-5-4-6-11-24)35-28-13-8-7-12-27(28)32(36)37/h3-8,10-20H,1,9,21H2,2H3,(H,38,39) |
| InChIKey | HAVPELFRRFHHTM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|