C30H22ClN3O5 — CID 126411375
4-[[2-chloro-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126411375) has the molecular formula C30H22ClN3O5 and a molecular weight of 539.98 g/mol. Its IUPAC name is 4-[[2-chloro-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126411375 |
| Molecular Formula | C30H22ClN3O5 |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-[[2-chloro-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H22ClN3O5/c1-38-26-16-20(15-24(31)27(26)39-18-19-11-13-22(14-12-19)30(36)37)17-32-34-28(21-7-3-2-4-8-21)33-25-10-6-5-9-23(25)29(34)35/h2-17H,18H2,1H3,(H,36,37) |
| InChIKey | ZCPZVLIANQAYFJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|