C33H24ClN3O7 — CID 126293177
4-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]methyl]benzoic acid (PubChem CID 126293177) has the molecular formula C33H24ClN3O7 and a molecular weight of 610.02 g/mol. Its IUPAC name is 4-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126293177 |
| Molecular Formula | C33H24ClN3O7 |
| Molecular Weight | 610.02 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | 4-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H24ClN3O7/c1-41-27-13-20(14-28(42-2)30(27)43-18-19-7-9-21(10-8-19)33(39)40)17-35-37-31(36-25-6-4-3-5-24(25)32(37)38)29-16-22-15-23(34)11-12-26(22)44-29/h3-17H,18H2,1-2H3,(H,39,40) |
| InChIKey | RUTKABVHICWCFQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.02 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|