C35H23ClIN3O4 — CID 126304070
2-(5-chloro-1-benzofuran-2-yl)-3-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126304070) has the molecular formula C35H23ClIN3O4 and a molecular weight of 711.94 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126304070 |
| Molecular Formula | C35H23ClIN3O4 |
| Molecular Weight | 711.94 g/mol |
| Exact Mass | 711.04 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C35H23ClIN3O4/c1-42-31-16-21(15-28(37)33(31)43-20-23-9-6-8-22-7-2-3-10-26(22)23)19-38-40-34(39-29-12-5-4-11-27(29)35(40)41)32-18-24-17-25(36)13-14-30(24)44-32/h2-19H,20H2,1H3 |
| InChIKey | YAGZVDKHOUGGIR-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.94 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|