C28H21ClIN3O6 — CID 126307043
methyl (2R)-2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodo-6-methoxyphenoxy]propanoate (PubChem CID 126307043) has the molecular formula C28H21ClIN3O6 and a molecular weight of 657.85 g/mol. Its IUPAC name is methyl (2R)-2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodo-6-methoxyphenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodo-6-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126307043 |
| Molecular Formula | C28H21ClIN3O6 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.02 |
| IUPAC Name | methyl (2R)-2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodo-6-methoxyphenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(I)cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C28H21ClIN3O6/c1-15(28(35)37-3)38-25-20(30)10-16(11-23(25)36-2)14-31-33-26(32-21-7-5-4-6-19(21)27(33)34)24-13-17-12-18(29)8-9-22(17)39-24/h4-15H,1-3H3/t15-/m1/s1 |
| InChIKey | YQWGHJDPCKEKSL-OAHLLOKOSA-N |
| XLogP | 5.90 |
| TPSA | 105.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|