C25H17ClIN3O4 — CID 126287592
2-(5-chloro-1-benzofuran-2-yl)-3-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126287592) has the molecular formula C25H17ClIN3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126287592 |
| Molecular Formula | C25H17ClIN3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc(I)c1OC |
| InChI | InChI=1S/C25H17ClIN3O4/c1-32-21-10-14(9-18(27)23(21)33-2)13-28-30-24(29-19-6-4-3-5-17(19)25(30)31)22-12-15-11-16(26)7-8-20(15)34-22/h3-13H,1-2H3 |
| InChIKey | MIWCCXAINMPTRF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|