C31H19Cl3IN3O4 — CID 126303171
2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126303171) has the molecular formula C31H19Cl3IN3O4 and a molecular weight of 730.77 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126303171 |
| Molecular Formula | C31H19Cl3IN3O4 |
| Molecular Weight | 730.77 g/mol |
| Exact Mass | 728.95 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H19Cl3IN3O4/c1-40-27-12-18(11-24(35)29(27)41-16-17-6-8-22(33)23(34)10-17)15-36-38-30(37-25-5-3-2-4-21(25)31(38)39)28-14-19-13-20(32)7-9-26(19)42-28/h2-15H,16H2,1H3 |
| InChIKey | VKHKPMOKMOHADN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.77 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|