C31H18ClI2N3O5 — CID 126286758
3-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126286758) has the molecular formula C31H18ClI2N3O5 and a molecular weight of 801.76 g/mol. Its IUPAC name is 3-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126286758 |
| Molecular Formula | C31H18ClI2N3O5 |
| Molecular Weight | 801.76 g/mol |
| Exact Mass | 800.90 |
| IUPAC Name | 3-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(I)cc(C=Nn3c(-c4cc5cc(Cl)ccc5o4)nc4ccccc4c3=O)cc2I)c1 |
| InChI | InChI=1S/C31H18ClI2N3O5/c32-21-8-9-26-20(13-21)14-27(42-26)29-36-25-7-2-1-6-22(25)30(38)37(29)35-15-18-11-23(33)28(24(34)12-18)41-16-17-4-3-5-19(10-17)31(39)40/h1-15H,16H2,(H,39,40) |
| InChIKey | BRLYWBARCWGKAB-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.76 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|