C31H20ClN3O5 — CID 126307091
3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chlorophenoxy]methyl]benzoic acid (PubChem CID 126307091) has the molecular formula C31H20ClN3O5 and a molecular weight of 549.97 g/mol. Its IUPAC name is 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126307091 |
| Molecular Formula | C31H20ClN3O5 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 3-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chlorophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(C=Nn3c(-c4cc5ccccc5o4)nc4ccccc4c3=O)cc2Cl)c1 |
| InChI | InChI=1S/C31H20ClN3O5/c32-24-15-19(12-13-27(24)39-18-20-6-5-8-22(14-20)31(37)38)17-33-35-29(28-16-21-7-1-4-11-26(21)40-28)34-25-10-3-2-9-23(25)30(35)36/h1-17H,18H2,(H,37,38) |
| InChIKey | YXRQPBHCIGILOT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|