C31H19BrClN3O5 — CID 126310435
4-[[2-bromo-4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126310435) has the molecular formula C31H19BrClN3O5 and a molecular weight of 628.87 g/mol. Its IUPAC name is 4-[[2-bromo-4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126310435 |
| Molecular Formula | C31H19BrClN3O5 |
| Molecular Weight | 628.87 g/mol |
| Exact Mass | 627.02 |
| IUPAC Name | 4-[[2-bromo-4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(C=Nn3c(-c4cc5cc(Cl)ccc5o4)nc4ccccc4c3=O)cc2Br)cc1 |
| InChI | InChI=1S/C31H19BrClN3O5/c32-24-13-19(7-11-27(24)40-17-18-5-8-20(9-6-18)31(38)39)16-34-36-29(35-25-4-2-1-3-23(25)30(36)37)28-15-21-14-22(33)10-12-26(21)41-28/h1-16H,17H2,(H,38,39) |
| InChIKey | KSTAYUJQCJNPBX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.87 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|