C31H19Cl2N3O5 — CID 126294424
4-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzoic acid (PubChem CID 126294424) has the molecular formula C31H19Cl2N3O5 and a molecular weight of 584.42 g/mol. Its IUPAC name is 4-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126294424 |
| Molecular Formula | C31H19Cl2N3O5 |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 4-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(Cl)cc(C=Nn3c(-c4cc5ccccc5o4)nc4ccccc4c3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C31H19Cl2N3O5/c32-23-13-19(14-24(33)28(23)40-17-18-9-11-20(12-10-18)31(38)39)16-34-36-29(27-15-21-5-1-4-8-26(21)41-27)35-25-7-3-2-6-22(25)30(36)37/h1-16H,17H2,(H,38,39) |
| InChIKey | FMRAKJLHVRTFSN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|