C30H18BrCl2N3O3 — CID 126299238
2-(5-bromo-1-benzofuran-2-yl)-3-[(3,5-dichloro-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126299238) has the molecular formula C30H18BrCl2N3O3 and a molecular weight of 619.30 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(3,5-dichloro-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3,5-dichloro-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126299238 |
| Molecular Formula | C30H18BrCl2N3O3 |
| Molecular Weight | 619.30 g/mol |
| Exact Mass | 616.99 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3,5-dichloro-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1cc(Cl)c(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C30H18BrCl2N3O3/c31-21-10-11-26-20(14-21)15-27(39-26)29-35-25-9-5-4-8-22(25)30(37)36(29)34-16-19-12-23(32)28(24(33)13-19)38-17-18-6-2-1-3-7-18/h1-16H,17H2 |
| InChIKey | GYXFBEXVKUWLFD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.30 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|