C26H16BrCl2N3O5 — CID 126299456
(2S)-2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]propanoic acid (PubChem CID 126299456) has the molecular formula C26H16BrCl2N3O5 and a molecular weight of 601.24 g/mol. Its IUPAC name is (2S)-2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126299456 |
| Molecular Formula | C26H16BrCl2N3O5 |
| Molecular Weight | 601.24 g/mol |
| Exact Mass | 598.97 |
| IUPAC Name | (2S)-2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
| SMILES | C[C@H](Oc1c(Cl)cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C26H16BrCl2N3O5/c1-13(26(34)35)36-23-18(28)8-14(9-19(23)29)12-30-32-24(31-20-5-3-2-4-17(20)25(32)33)22-11-15-10-16(27)6-7-21(15)37-22/h2-13H,1H3,(H,34,35)/t13-/m0/s1 |
| InChIKey | XUECBYLGTMCFMI-ZDUSSCGKSA-N |
| XLogP | 6.61 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.24 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|