C29H23BrClN3O6 — CID 126311822
ethyl 2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate (PubChem CID 126311822) has the molecular formula C29H23BrClN3O6 and a molecular weight of 624.87 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126311822 |
| Molecular Formula | C29H23BrClN3O6 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | ethyl 2-[4-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1OCC |
| InChI | InChI=1S/C29H23BrClN3O6/c1-3-37-24-12-17(11-21(31)27(24)39-16-26(35)38-4-2)15-32-34-28(33-22-8-6-5-7-20(22)29(34)36)25-14-18-13-19(30)9-10-23(18)40-25/h5-15H,3-4,16H2,1-2H3 |
| InChIKey | NIMOUVCPWJAAOL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 105.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|