C25H16BrClN4O5 — CID 126301363
2-(5-bromo-1-benzofuran-2-yl)-3-[(3-chloro-4-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126301363) has the molecular formula C25H16BrClN4O5 and a molecular weight of 567.78 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-chloro-4-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-chloro-4-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126301363 |
| Molecular Formula | C25H16BrClN4O5 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 566.00 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-chloro-4-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1c(Cl)cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H16BrClN4O5/c1-2-35-23-18(27)9-14(10-20(23)31(33)34)13-28-30-24(29-19-6-4-3-5-17(19)25(30)32)22-12-15-11-16(26)7-8-21(15)36-22/h3-13H,2H2,1H3 |
| InChIKey | QFGIBPSNKWLSRU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|