C26H16Br2N4O5 — CID 126288813
2-(5-bromo-1-benzofuran-2-yl)-3-[(3-bromo-5-nitro-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126288813) has the molecular formula C26H16Br2N4O5 and a molecular weight of 624.25 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-bromo-5-nitro-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-bromo-5-nitro-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126288813 |
| Molecular Formula | C26H16Br2N4O5 |
| Molecular Weight | 624.25 g/mol |
| Exact Mass | 621.95 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(3-bromo-5-nitro-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCOc1c(Br)cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H16Br2N4O5/c1-2-9-36-24-19(28)10-15(11-21(24)32(34)35)14-29-31-25(30-20-6-4-3-5-18(20)26(31)33)23-13-16-12-17(27)7-8-22(16)37-23/h2-8,10-14H,1,9H2 |
| InChIKey | PDXXLIKADOUTDS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.25 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|