C30H16BrCl3N4O5 — CID 126299918
3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126299918) has the molecular formula C30H16BrCl3N4O5 and a molecular weight of 698.74 g/mol. Its IUPAC name is 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126299918 |
| Molecular Formula | C30H16BrCl3N4O5 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 695.94 |
| IUPAC Name | 3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1cc(Br)c(OCc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H16BrCl3N4O5/c31-22-9-16(10-25(38(40)41)28(22)42-15-17-5-6-20(33)13-23(17)34)14-35-37-29(36-24-4-2-1-3-21(24)30(37)39)27-12-18-11-19(32)7-8-26(18)43-27/h1-14H,15H2 |
| InChIKey | ZSNVMOWGOULWQV-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|