C30H17BrCl2N4O5 — CID 126296293
2-(1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126296293) has the molecular formula C30H17BrCl2N4O5 and a molecular weight of 664.30 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126296293 |
| Molecular Formula | C30H17BrCl2N4O5 |
| Molecular Weight | 664.30 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H17BrCl2N4O5/c31-20-11-19(28(25(13-20)37(39)40)41-16-18-9-10-21(32)14-23(18)33)15-34-36-29(27-12-17-5-1-4-8-26(17)42-27)35-24-7-3-2-6-22(24)30(36)38/h1-15H,16H2 |
| InChIKey | KFLUXXOODVWZEB-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.30 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|