C31H18ClN5O5 — CID 126295730
2-[[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzonitrile (PubChem CID 126295730) has the molecular formula C31H18ClN5O5 and a molecular weight of 575.97 g/mol. Its IUPAC name is 2-[[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126295730 |
| Molecular Formula | C31H18ClN5O5 |
| Molecular Weight | 575.97 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 2-[[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H18ClN5O5/c32-23-13-22(29(26(15-23)37(39)40)41-18-21-9-2-1-8-20(21)16-33)17-34-36-30(28-14-19-7-3-6-12-27(19)42-28)35-25-11-5-4-10-24(25)31(36)38/h1-15,17H,18H2 |
| InChIKey | HCDKLQYHMSZDFB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.97 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|