C28H15ClN6O7 — CID 126306700
2-(1-benzofuran-2-yl)-3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126306700) has the molecular formula C28H15ClN6O7 and a molecular weight of 582.92 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126306700 |
| Molecular Formula | C28H15ClN6O7 |
| Molecular Weight | 582.92 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C28H15ClN6O7/c29-18-11-17(26(22(13-18)35(39)40)42-25-10-9-19(15-30-25)34(37)38)14-31-33-27(24-12-16-5-1-4-8-23(16)41-24)32-21-7-3-2-6-20(21)28(33)36/h1-15H |
| InChIKey | ZQFMNLAFKNAQNO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 168.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|