C30H19Br2N5O6 — CID 126313626
2-(1-benzofuran-2-yl)-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126313626) has the molecular formula C30H19Br2N5O6 and a molecular weight of 705.32 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126313626 |
| Molecular Formula | C30H19Br2N5O6 |
| Molecular Weight | 705.32 g/mol |
| Exact Mass | 702.97 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(Br)c(Br)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C30H19Br2N5O6/c1-2-41-23-14-18(26(31)27(32)28(23)43-25-12-11-19(16-33-25)37(39)40)15-34-36-29(24-13-17-7-3-6-10-22(17)42-24)35-21-9-5-4-8-20(21)30(36)38/h3-16H,2H2,1H3 |
| InChIKey | SNYOQAOZTGFZSO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 134.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.32 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|