C32H23Br2N3O4 — CID 126287462
2-(1-benzofuran-2-yl)-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126287462) has the molecular formula C32H23Br2N3O4 and a molecular weight of 673.36 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126287462 |
| Molecular Formula | C32H23Br2N3O4 |
| Molecular Weight | 673.36 g/mol |
| Exact Mass | 671.01 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(Br)c(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H23Br2N3O4/c1-2-39-26-17-22(28(33)29(34)30(26)40-19-20-10-4-3-5-11-20)18-35-37-31(27-16-21-12-6-9-15-25(21)41-27)36-24-14-8-7-13-23(24)32(37)38/h3-18H,2,19H2,1H3 |
| InChIKey | CXLLBJGLXUWJMS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.36 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|