C32H24IN3O4 — CID 126307025
2-(1-benzofuran-2-yl)-3-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126307025) has the molecular formula C32H24IN3O4 and a molecular weight of 641.47 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126307025 |
| Molecular Formula | C32H24IN3O4 |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H24IN3O4/c1-2-38-28-17-22(16-25(33)30(28)39-20-21-10-4-3-5-11-21)19-34-36-31(29-18-23-12-6-9-15-27(23)40-29)35-26-14-8-7-13-24(26)32(36)37/h3-19H,2,20H2,1H3 |
| InChIKey | ARSRCNDKWCPZNI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|