C36H31N3O4 — CID 126287720
2-(1-benzofuran-2-yl)-3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126287720) has the molecular formula C36H31N3O4 and a molecular weight of 569.66 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126287720 |
| Molecular Formula | C36H31N3O4 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(OCC)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C36H31N3O4/c1-4-11-28-19-26(20-32(41-5-2)34(28)42-23-25-13-10-12-24(3)18-25)22-37-39-35(33-21-27-14-6-9-17-31(27)43-33)38-30-16-8-7-15-29(30)36(39)40/h4,6-10,12-22H,1,5,11,23H2,2-3H3 |
| InChIKey | DXOIUYUYPVWFJR-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|