C35H27Br2N3O4 — CID 126285779
2-(1-benzofuran-2-yl)-3-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126285779) has the molecular formula C35H27Br2N3O4 and a molecular weight of 713.43 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126285779 |
| Molecular Formula | C35H27Br2N3O4 |
| Molecular Weight | 713.43 g/mol |
| Exact Mass | 711.04 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(OCC)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C35H27Br2N3O4/c1-3-9-24-16-22(17-31(42-4-2)33(24)43-21-25-14-15-26(36)19-28(25)37)20-38-40-34(32-18-23-10-5-8-13-30(23)44-32)39-29-12-7-6-11-27(29)35(40)41/h3,5-8,10-20H,1,4,9,21H2,2H3 |
| InChIKey | IFNXBVWYLNHLFU-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.43 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|