C34H25BrFN3O4 — CID 126285572
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126285572) has the molecular formula C34H25BrFN3O4 and a molecular weight of 638.49 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126285572 |
| Molecular Formula | C34H25BrFN3O4 |
| Molecular Weight | 638.49 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C34H25BrFN3O4/c1-3-6-23-15-22(16-30(41-2)32(23)42-20-21-9-12-26(36)13-10-21)19-37-39-33(38-28-8-5-4-7-27(28)34(39)40)31-18-24-17-25(35)11-14-29(24)43-31/h3-5,7-19H,1,6,20H2,2H3 |
| InChIKey | IQMVICOQKWLNKM-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.49 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|