C30H19BrFN3O3 — CID 126295396
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126295396) has the molecular formula C30H19BrFN3O3 and a molecular weight of 568.40 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126295396 |
| Molecular Formula | C30H19BrFN3O3 |
| Molecular Weight | 568.40 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H19BrFN3O3/c31-22-9-14-27-21(15-22)16-28(38-27)29-34-26-4-2-1-3-25(26)30(36)35(29)33-17-19-7-12-24(13-8-19)37-18-20-5-10-23(32)11-6-20/h1-17H,18H2 |
| InChIKey | LRTRZBKGIJMZQE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.40 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|