C31H22ClN3O3 — CID 126289842
2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126289842) has the molecular formula C31H22ClN3O3 and a molecular weight of 519.99 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126289842 |
| Molecular Formula | C31H22ClN3O3 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1ccc(COc2ccc(C=Nn3c(-c4cc5cc(Cl)ccc5o4)nc4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C31H22ClN3O3/c1-20-6-8-22(9-7-20)19-37-25-13-10-21(11-14-25)18-33-35-30(34-27-5-3-2-4-26(27)31(35)36)29-17-23-16-24(32)12-15-28(23)38-29/h2-18H,19H2,1H3 |
| InChIKey | SIJSHHAYYMCJTD-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|