C36H26Cl2N4O3 — CID 126304919
2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-[(4-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126304919) has the molecular formula C36H26Cl2N4O3 and a molecular weight of 633.54 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-[(4-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-[(4-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126304919 |
| Molecular Formula | C36H26Cl2N4O3 |
| Molecular Weight | 633.54 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-[(4-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c(C)n1-c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H26Cl2N4O3/c1-22-17-26(23(2)41(22)29-12-14-30(15-13-29)44-21-24-7-9-27(37)10-8-24)20-39-42-35(40-32-6-4-3-5-31(32)36(42)43)34-19-25-18-28(38)11-16-33(25)45-34/h3-20H,21H2,1-2H3 |
| InChIKey | OFIBZTOPWXENPV-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.54 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|