C37H29ClN4O3 — CID 126299393
2-(5-chloro-1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-methylphenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126299393) has the molecular formula C37H29ClN4O3 and a molecular weight of 613.12 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-methylphenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-methylphenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126299393 |
| Molecular Formula | C37H29ClN4O3 |
| Molecular Weight | 613.12 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-methylphenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(COc2ccc(-n3c(C)cc(C=Nn4c(-c5cc6cc(Cl)ccc6o5)nc5ccccc5c4=O)c3C)cc2)c1 |
| InChI | InChI=1S/C37H29ClN4O3/c1-23-7-6-8-26(17-23)22-44-31-14-12-30(13-15-31)41-24(2)18-28(25(41)3)21-39-42-36(40-33-10-5-4-9-32(33)37(42)43)35-20-27-19-29(38)11-16-34(27)45-35/h4-21H,22H2,1-3H3 |
| InChIKey | HIHMFLLFGZDIRR-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.12 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|