C31H25ClN4O2 — CID 126289451
2-(5-chloro-1-benzofuran-2-yl)-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126289451) has the molecular formula C31H25ClN4O2 and a molecular weight of 521.02 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126289451 |
| Molecular Formula | C31H25ClN4O2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(C)c1-n1c(C)cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C31H25ClN4O2/c1-18-8-7-9-19(2)29(18)35-20(3)14-23(21(35)4)17-33-36-30(34-26-11-6-5-10-25(26)31(36)37)28-16-22-15-24(32)12-13-27(22)38-28/h5-17H,1-4H3 |
| InChIKey | RZHZUSPNNQVQGU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|