C37H27ClN4O5 — CID 126285020
3-[[4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid (PubChem CID 126285020) has the molecular formula C37H27ClN4O5 and a molecular weight of 643.10 g/mol. Its IUPAC name is 3-[[4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126285020 |
| Molecular Formula | C37H27ClN4O5 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | 3-[[4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c(C)n1-c1ccc(OCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C37H27ClN4O5/c1-22-16-27(23(2)41(22)29-11-13-30(14-12-29)46-21-24-6-5-7-25(17-24)37(44)45)20-39-42-35(40-32-9-4-3-8-31(32)36(42)43)34-19-26-18-28(38)10-15-33(26)47-34/h3-20H,21H2,1-2H3,(H,44,45) |
| InChIKey | FRDQXDAMYINCFO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|