C30H25BrN4O4 — CID 126297981
3-[[4-[3-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid (PubChem CID 126297981) has the molecular formula C30H25BrN4O4 and a molecular weight of 585.46 g/mol. Its IUPAC name is 3-[[4-[3-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[3-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126297981 |
| Molecular Formula | C30H25BrN4O4 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 3-[[4-[3-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c(C)n1-c1ccc(OCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C30H25BrN4O4/c1-18-13-23(16-32-35-20(3)33-28-12-7-24(31)15-27(28)29(35)36)19(2)34(18)25-8-10-26(11-9-25)39-17-21-5-4-6-22(14-21)30(37)38/h4-16H,17H2,1-3H3,(H,37,38) |
| InChIKey | DPPNTEBIPJLFQZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|