C32H31BrN4O2 — CID 126315392
6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126315392) has the molecular formula C32H31BrN4O2 and a molecular weight of 583.53 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126315392 |
| Molecular Formula | C32H31BrN4O2 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C32H31BrN4O2/c1-5-21(2)31-35-30-16-11-26(33)18-29(30)32(38)37(31)34-19-25-17-22(3)36(23(25)4)27-12-14-28(15-13-27)39-20-24-9-7-6-8-10-24/h6-19,21H,5,20H2,1-4H3/t21-/m1/s1 |
| InChIKey | DFZAYWDRWCNOKD-OAQYLSRUSA-N |
| XLogP | 7.54 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|