C32H29BrCl2N4O2 — CID 126341482
6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126341482) has the molecular formula C32H29BrCl2N4O2 and a molecular weight of 652.42 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126341482 |
| Molecular Formula | C32H29BrCl2N4O2 |
| Molecular Weight | 652.42 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)c1C |
| InChI | InChI=1S/C32H29BrCl2N4O2/c1-5-19(2)31-37-30-13-7-24(33)15-28(30)32(40)39(31)36-17-23-14-20(3)38(21(23)4)26-9-11-27(12-10-26)41-18-22-6-8-25(34)16-29(22)35/h6-17,19H,5,18H2,1-4H3/t19-/m1/s1 |
| InChIKey | VXAWNKOWDYXWBP-LJQANCHMSA-N |
| XLogP | 8.85 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.42 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|