C31H34BrN5O4 — CID 126326229
6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126326229) has the molecular formula C31H34BrN5O4 and a molecular weight of 620.55 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126326229 |
| Molecular Formula | C31H34BrN5O4 |
| Molecular Weight | 620.55 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[2,5-dimethyl-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCC(=O)N3CCOCC3)cc2)c1C |
| InChI | InChI=1S/C31H34BrN5O4/c1-5-20(2)30-34-28-11-6-24(32)17-27(28)31(39)37(30)33-18-23-16-21(3)36(22(23)4)25-7-9-26(10-8-25)41-19-29(38)35-12-14-40-15-13-35/h6-11,16-18,20H,5,12-15,19H2,1-4H3/t20-/m1/s1 |
| InChIKey | BRGDPGJUYIXCSZ-HXUWFJFHSA-N |
| XLogP | 5.20 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|