C27H26BrN5O2 — CID 126311430
2-[4-[3-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetonitrile (PubChem CID 126311430) has the molecular formula C27H26BrN5O2 and a molecular weight of 532.44 g/mol. Its IUPAC name is 2-[4-[3-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[3-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126311430 |
| Molecular Formula | C27H26BrN5O2 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 2-[4-[3-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]acetonitrile |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCC#N)cc2)c1C |
| InChI | InChI=1S/C27H26BrN5O2/c1-5-17(2)26-31-25-11-6-21(28)15-24(25)27(34)33(26)30-16-20-14-18(3)32(19(20)4)22-7-9-23(10-8-22)35-13-12-29/h6-11,14-17H,5,13H2,1-4H3/t17-/m1/s1 |
| InChIKey | UOBZBFPOEQESMC-QGZVFWFLSA-N |
| XLogP | 5.86 |
| TPSA | 85.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|