C29H23Br3N4O2 — CID 126297680
6-bromo-3-[[1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126297680) has the molecular formula C29H23Br3N4O2 and a molecular weight of 699.24 g/mol. Its IUPAC name is 6-bromo-3-[[1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126297680 |
| Molecular Formula | C29H23Br3N4O2 |
| Molecular Weight | 699.24 g/mol |
| Exact Mass | 695.94 |
| IUPAC Name | 6-bromo-3-[[1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c(C)n1-c1ccc(OCc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C29H23Br3N4O2/c1-17-12-21(15-33-36-19(3)34-28-11-6-22(30)13-26(28)29(36)37)18(2)35(17)24-7-9-25(10-8-24)38-16-20-4-5-23(31)14-27(20)32/h4-15H,16H2,1-3H3 |
| InChIKey | CXLZKBRMRDQFNN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.24 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|