C24H23BrN4O — CID 126293560
6-bromo-3-[[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126293560) has the molecular formula C24H23BrN4O and a molecular weight of 463.38 g/mol. Its IUPAC name is 6-bromo-3-[[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126293560 |
| Molecular Formula | C24H23BrN4O |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 6-bromo-3-[[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCc1ccc(-n2c(C)cc(C=Nn3c(C)nc4ccc(Br)cc4c3=O)c2C)cc1 |
| InChI | InChI=1S/C24H23BrN4O/c1-5-18-6-9-21(10-7-18)28-15(2)12-19(16(28)3)14-26-29-17(4)27-23-11-8-20(25)13-22(23)24(29)30/h6-14H,5H2,1-4H3 |
| InChIKey | UVMLIAJOKBCKBO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|