C25H25BrN4O — CID 126291584
6-bromo-3-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126291584) has the molecular formula C25H25BrN4O and a molecular weight of 477.41 g/mol. Its IUPAC name is 6-bromo-3-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126291584 |
| Molecular Formula | C25H25BrN4O |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 6-bromo-3-[[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1cc(C)c(-n2c(C)cc(C=Nn3c(C)nc4ccc(Br)cc4c3=O)c2C)c(C)c1 |
| InChI | InChI=1S/C25H25BrN4O/c1-14-9-15(2)24(16(3)10-14)29-17(4)11-20(18(29)5)13-27-30-19(6)28-23-8-7-21(26)12-22(23)25(30)31/h7-13H,1-6H3 |
| InChIKey | NROCLCDUXVFQTR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|