C25H25BrN4O2 — CID 126296368
6-bromo-3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126296368) has the molecular formula C25H25BrN4O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is 6-bromo-3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126296368 |
| Molecular Formula | C25H25BrN4O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 6-bromo-3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c(C)n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C25H25BrN4O2/c1-15(2)32-22-9-7-21(8-10-22)29-16(3)12-19(17(29)4)14-27-30-18(5)28-24-11-6-20(26)13-23(24)25(30)31/h6-15H,1-5H3 |
| InChIKey | RKBMQWOEFOKMRG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|