C26H28BrN5O — CID 126292092
6-bromo-3-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126292092) has the molecular formula C26H28BrN5O and a molecular weight of 506.45 g/mol. Its IUPAC name is 6-bromo-3-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126292092 |
| Molecular Formula | C26H28BrN5O |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 6-bromo-3-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(C=Nn3c(C)nc4ccc(Br)cc4c3=O)c2C)cc1 |
| InChI | InChI=1S/C26H28BrN5O/c1-6-30(7-2)22-9-11-23(12-10-22)31-17(3)14-20(18(31)4)16-28-32-19(5)29-25-13-8-21(27)15-24(25)26(32)33/h8-16H,6-7H2,1-5H3 |
| InChIKey | PGANYHWVVLDBDM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|