C22H25BrN4O — CID 126299082
6-bromo-3-[(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126299082) has the molecular formula C22H25BrN4O and a molecular weight of 441.37 g/mol. Its IUPAC name is 6-bromo-3-[(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126299082 |
| Molecular Formula | C22H25BrN4O |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 6-bromo-3-[(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C22H25BrN4O/c1-14-11-17(15(2)26(14)19-7-5-4-6-8-19)13-24-27-16(3)25-21-10-9-18(23)12-20(21)22(27)28/h9-13,19H,4-8H2,1-3H3 |
| InChIKey | IULHGSGAWFFGRK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|