C29H31BrN4O — CID 126323988
6-bromo-2-cyclohexyl-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126323988) has the molecular formula C29H31BrN4O and a molecular weight of 531.50 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323988 |
| Molecular Formula | C29H31BrN4O |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(C)c1-n1c(C)cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)c1C |
| InChI | InChI=1S/C29H31BrN4O/c1-18-9-8-10-19(2)27(18)33-20(3)15-23(21(33)4)17-31-34-28(22-11-6-5-7-12-22)32-26-14-13-24(30)16-25(26)29(34)35/h8-10,13-17,22H,5-7,11-12H2,1-4H3 |
| InChIKey | WHNIIBJMCLDYBK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|